C15H15N3O3 — CID 42891284
2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-prop-2-ynylacetamide (PubChem CID 42891284) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-prop-2-ynylacetamide.
| Compound Name | 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 42891284 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CN1C(=O)NC(C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C15H15N3O3/c1-3-9-16-12(19)10-18-13(20)15(2,17-14(18)21)11-7-5-4-6-8-11/h1,4-8H,9-10H2,2H3,(H,16,19)(H,17,21) |
| InChIKey | GTABQRGUUXCMMB-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|