C19H18N4O4 — CID 26865674
N'-[2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]benzohydrazide (PubChem CID 26865674) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is N'-[2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 26865674 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N'-[2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]benzohydrazide |
| SMILES | C[C@]1(c2ccccc2)NC(=O)N(CC(=O)NNC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C19H18N4O4/c1-19(14-10-6-3-7-11-14)17(26)23(18(27)20-19)12-15(24)21-22-16(25)13-8-4-2-5-9-13/h2-11H,12H2,1H3,(H,20,27)(H,21,24)(H,22,25)/t19-/m1/s1 |
| InChIKey | JVRAIEVKFAHLPK-LJQANCHMSA-N |
| XLogP | 0.91 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|