C19H17FN4O4 — CID 25162375
2-fluoro-N'-[2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]benzohydrazide (PubChem CID 25162375) has the molecular formula C19H17FN4O4 and a molecular weight of 384.37 g/mol. Its IUPAC name is 2-fluoro-N'-[2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 25162375 |
| Molecular Formula | C19H17FN4O4 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-fluoro-N'-[2-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]benzohydrazide |
| SMILES | CC1(c2ccccc2)NC(=O)N(CC(=O)NNC(=O)c2ccccc2F)C1=O |
| InChI | InChI=1S/C19H17FN4O4/c1-19(12-7-3-2-4-8-12)17(27)24(18(28)21-19)11-15(25)22-23-16(26)13-9-5-6-10-14(13)20/h2-10H,11H2,1H3,(H,21,28)(H,22,25)(H,23,26) |
| InChIKey | SRPNERUUVKBWFJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|