C22H19FN4O5 — CID 55506822
N'-[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-3-methyl-1-benzofuran-2-carbohydrazide (PubChem CID 55506822) has the molecular formula C22H19FN4O5 and a molecular weight of 438.42 g/mol. Its IUPAC name is N'-[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-3-methyl-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-3-methyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 55506822 |
| Molecular Formula | C22H19FN4O5 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N'-[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-3-methyl-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)CN2C(=O)NC(C)(c3ccc(F)cc3)C2=O)oc2ccccc12 |
| InChI | InChI=1S/C22H19FN4O5/c1-12-15-5-3-4-6-16(15)32-18(12)19(29)26-25-17(28)11-27-20(30)22(2,24-21(27)31)13-7-9-14(23)10-8-13/h3-10H,11H2,1-2H3,(H,24,31)(H,25,28)(H,26,29) |
| InChIKey | MTZPJNQEWAWZJS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|