C21H24N4O5 — CID 46652794
3-methyl-N'-[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-1-benzofuran-2-carbohydrazide (PubChem CID 46652794) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 3-methyl-N'-[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-1-benzofuran-2-carbohydrazide.
| Compound Name | 3-methyl-N'-[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 46652794 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 3-methyl-N'-[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)CN2C(=O)NC3(CCCCC3C)C2=O)oc2ccccc12 |
| InChI | InChI=1S/C21H24N4O5/c1-12-7-5-6-10-21(12)19(28)25(20(29)22-21)11-16(26)23-24-18(27)17-13(2)14-8-3-4-9-15(14)30-17/h3-4,8-9,12H,5-7,10-11H2,1-2H3,(H,22,29)(H,23,26)(H,24,27) |
| InChIKey | LTCVKGXKRNMESE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|