C18H21BrN4O4 — CID 2538583
4-bromo-N'-[2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]benzohydrazide (PubChem CID 2538583) has the molecular formula C18H21BrN4O4 and a molecular weight of 437.29 g/mol. Its IUPAC name is 4-bromo-N'-[2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]benzohydrazide.
| Compound Name | 4-bromo-N'-[2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 2538583 |
| Molecular Formula | C18H21BrN4O4 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 4-bromo-N'-[2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]benzohydrazide |
| SMILES | C[C@@H]1CCCC[C@@]12NC(=O)N(CC(=O)NNC(=O)c1ccc(Br)cc1)C2=O |
| InChI | InChI=1S/C18H21BrN4O4/c1-11-4-2-3-9-18(11)16(26)23(17(27)20-18)10-14(24)21-22-15(25)12-5-7-13(19)8-6-12/h5-8,11H,2-4,9-10H2,1H3,(H,20,27)(H,21,24)(H,22,25)/t11-,18-/m1/s1 |
| InChIKey | ZXPBOVROVPLHLV-ADLMAVQZSA-N |
| XLogP | 1.71 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|