C18H21BrN2O4 — CID 7955751
(4-bromophenyl)methyl 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 7955751) has the molecular formula C18H21BrN2O4 and a molecular weight of 409.28 g/mol. Its IUPAC name is (4-bromophenyl)methyl 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | (4-bromophenyl)methyl 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 7955751 |
| Molecular Formula | C18H21BrN2O4 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | (4-bromophenyl)methyl 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | C[C@H]1CCCC[C@]12NC(=O)N(CC(=O)OCc1ccc(Br)cc1)C2=O |
| InChI | InChI=1S/C18H21BrN2O4/c1-12-4-2-3-9-18(12)16(23)21(17(24)20-18)10-15(22)25-11-13-5-7-14(19)8-6-13/h5-8,12H,2-4,9-11H2,1H3,(H,20,24)/t12-,18-/m0/s1 |
| InChIKey | UNIZXVODERZXEH-SGTLLEGYSA-N |
| XLogP | 2.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|