C18H20ClFN2O4 — CID 7955778
(2-chloro-6-fluorophenyl)methyl 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 7955778) has the molecular formula C18H20ClFN2O4 and a molecular weight of 382.82 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 7955778 |
| Molecular Formula | C18H20ClFN2O4 |
| Molecular Weight | 382.82 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | C[C@@H]1CCCC[C@@]12NC(=O)N(CC(=O)OCc1c(F)cccc1Cl)C2=O |
| InChI | InChI=1S/C18H20ClFN2O4/c1-11-5-2-3-8-18(11)16(24)22(17(25)21-18)9-15(23)26-10-12-13(19)6-4-7-14(12)20/h4,6-7,11H,2-3,5,8-10H2,1H3,(H,21,25)/t11-,18-/m1/s1 |
| InChIKey | QXDOTQCXTICWAD-ADLMAVQZSA-N |
| XLogP | 3.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.82 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|