C20H25FN2O5 — CID 7469448
3-(4-fluorophenoxy)propyl 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 7469448) has the molecular formula C20H25FN2O5 and a molecular weight of 392.43 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)propyl 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | 3-(4-fluorophenoxy)propyl 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 7469448 |
| Molecular Formula | C20H25FN2O5 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-(4-fluorophenoxy)propyl 2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | C[C@@H]1CCCC[C@]12NC(=O)N(CC(=O)OCCCOc1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C20H25FN2O5/c1-14-5-2-3-10-20(14)18(25)23(19(26)22-20)13-17(24)28-12-4-11-27-16-8-6-15(21)7-9-16/h6-9,14H,2-5,10-13H2,1H3,(H,22,26)/t14-,20+/m1/s1 |
| InChIKey | HKDXTDPLXPHMCH-VLIAUNLRSA-N |
| XLogP | 2.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|