C23H27N3O6 — CID 41072018
4-(1,3-dioxoisoindol-2-yl)butyl 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 41072018) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 41072018 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | C[C@@H]1CCCC[C@@]12NC(=O)N(CC(=O)OCCCCN1C(=O)c3ccccc3C1=O)C2=O |
| InChI | InChI=1S/C23H27N3O6/c1-15-8-4-5-11-23(15)21(30)26(22(31)24-23)14-18(27)32-13-7-6-12-25-19(28)16-9-2-3-10-17(16)20(25)29/h2-3,9-10,15H,4-8,11-14H2,1H3,(H,24,31)/t15-,23-/m1/s1 |
| InChIKey | HAZQMALDPONVBS-IQMFZBJNSA-N |
| XLogP | 2.11 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|