C19H22ClN3O5 — CID 7480009
[2-(2-chloroanilino)-2-oxoethyl] 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 7480009) has the molecular formula C19H22ClN3O5 and a molecular weight of 407.85 g/mol. Its IUPAC name is [2-(2-chloroanilino)-2-oxoethyl] 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | [2-(2-chloroanilino)-2-oxoethyl] 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 7480009 |
| Molecular Formula | C19H22ClN3O5 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [2-(2-chloroanilino)-2-oxoethyl] 2-[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | C[C@@H]1CCCC[C@@]12NC(=O)N(CC(=O)OCC(=O)Nc1ccccc1Cl)C2=O |
| InChI | InChI=1S/C19H22ClN3O5/c1-12-6-4-5-9-19(12)17(26)23(18(27)22-19)10-16(25)28-11-15(24)21-14-8-3-2-7-13(14)20/h2-3,7-8,12H,4-6,9-11H2,1H3,(H,21,24)(H,22,27)/t12-,19-/m1/s1 |
| InChIKey | OSIQULYMCHPKOX-CWTRNNRKSA-N |
| XLogP | 2.32 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|