C23H31N3O5 — CID 11906584
[2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 11906584) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is [2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | [2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 11906584 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | [2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)COC(=O)CN1C(=O)N[C@]2(CCCC[C@@H]2C)C1=O |
| InChI | InChI=1S/C23H31N3O5/c1-4-15(2)17-10-5-6-11-18(17)24-19(27)14-31-20(28)13-26-21(29)23(25-22(26)30)12-8-7-9-16(23)3/h5-6,10-11,15-16H,4,7-9,12-14H2,1-3H3,(H,24,27)(H,25,30)/t15-,16-,23-/m0/s1 |
| InChIKey | LEZXZFXZLVFQIH-KXNSMUHISA-N |
| XLogP | 3.18 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|