C20H24ClFN2O4 — CID 7652037
(2-chloro-6-fluorophenyl)methyl 2-[(5R,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 7652037) has the molecular formula C20H24ClFN2O4 and a molecular weight of 410.87 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 2-[(5R,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl 2-[(5R,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 7652037 |
| Molecular Formula | C20H24ClFN2O4 |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 2-[(5R,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | C[C@H]1CC(C)(C)C[C@@]2(C1)NC(=O)N(CC(=O)OCc1c(F)cccc1Cl)C2=O |
| InChI | InChI=1S/C20H24ClFN2O4/c1-12-7-19(2,3)11-20(8-12)17(26)24(18(27)23-20)9-16(25)28-10-13-14(21)5-4-6-15(13)22/h4-6,12H,7-11H2,1-3H3,(H,23,27)/t12-,20+/m0/s1 |
| InChIKey | UXNDCSGCEJGAHP-FKIZINRSSA-N |
| XLogP | 3.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|