C17H28N2O5 — CID 95266651
2-ethoxyethyl 2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 95266651) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | 2-ethoxyethyl 2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 95266651 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 2-ethoxyethyl 2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | CCOCCOC(=O)CN1C(=O)N[C@@]2(C[C@H](C)CC(C)(C)C2)C1=O |
| InChI | InChI=1S/C17H28N2O5/c1-5-23-6-7-24-13(20)10-19-14(21)17(18-15(19)22)9-12(2)8-16(3,4)11-17/h12H,5-11H2,1-4H3,(H,18,22)/t12-,17-/m1/s1 |
| InChIKey | IQERVBAEBYNESW-SJKOYZFVSA-N |
| XLogP | 1.70 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|