C23H33N3O7S — CID 24524058
2-[4-(dimethylsulfamoyl)phenoxy]ethyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 24524058) has the molecular formula C23H33N3O7S and a molecular weight of 495.60 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 24524058 |
| Molecular Formula | C23H33N3O7S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)OCCOc1ccc(S(=O)(=O)N(C)C)cc1)C2=O |
| InChI | InChI=1S/C23H33N3O7S/c1-16-12-22(2,3)15-23(13-16)20(28)26(21(29)24-23)14-19(27)33-11-10-32-17-6-8-18(9-7-17)34(30,31)25(4)5/h6-9,16H,10-15H2,1-5H3,(H,24,29) |
| InChIKey | HKYBGBPOBPDJMK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|