C26H27N3O4 — CID 41169686
[4-(4-cyanophenyl)phenyl] 2-[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 41169686) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 2-[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 2-[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 41169686 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 2-[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | C[C@@H]1CC(C)(C)C[C@]2(C1)NC(=O)N(CC(=O)Oc1ccc(-c3ccc(C#N)cc3)cc1)C2=O |
| InChI | InChI=1S/C26H27N3O4/c1-17-12-25(2,3)16-26(13-17)23(31)29(24(32)28-26)15-22(30)33-21-10-8-20(9-11-21)19-6-4-18(14-27)5-7-19/h4-11,17H,12-13,15-16H2,1-3H3,(H,28,32)/t17-,26+/m1/s1 |
| InChIKey | XATLABYRRMJJGJ-QUGAMOGWSA-N |
| XLogP | 4.27 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|