C20H25N3O7 — CID 55340595
(4-methoxy-2-nitrophenyl) 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 55340595) has the molecular formula C20H25N3O7 and a molecular weight of 419.43 g/mol. Its IUPAC name is (4-methoxy-2-nitrophenyl) 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | (4-methoxy-2-nitrophenyl) 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 55340595 |
| Molecular Formula | C20H25N3O7 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (4-methoxy-2-nitrophenyl) 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | COc1ccc(OC(=O)CN2C(=O)NC3(CC(C)CC(C)(C)C3)C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H25N3O7/c1-12-8-19(2,3)11-20(9-12)17(25)22(18(26)21-20)10-16(24)30-15-6-5-13(29-4)7-14(15)23(27)28/h5-7,12H,8-11H2,1-4H3,(H,21,26) |
| InChIKey | KUUKUXXMZUGXTH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|