C22H33N3O4 — CID 51673238
(5R,9R)-3-[[(2,4-dimethoxyphenyl)methyl-methylamino]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 51673238) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is (5R,9R)-3-[[(2,4-dimethoxyphenyl)methyl-methylamino]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,9R)-3-[[(2,4-dimethoxyphenyl)methyl-methylamino]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 51673238 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (5R,9R)-3-[[(2,4-dimethoxyphenyl)methyl-methylamino]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1ccc(CN(C)CN2C(=O)N[C@@]3(C[C@H](C)CC(C)(C)C3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C22H33N3O4/c1-15-10-21(2,3)13-22(11-15)19(26)25(20(27)23-22)14-24(4)12-16-7-8-17(28-5)9-18(16)29-6/h7-9,15H,10-14H2,1-6H3,(H,23,27)/t15-,22-/m1/s1 |
| InChIKey | BMAZDLGGYZPHGF-IVZQSRNASA-N |
| XLogP | 3.23 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|