C23H30N2O6 — CID 92509727
(5-acetyl-2-methoxyphenyl)methyl 2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 92509727) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl 2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl 2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 92509727 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl 2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | COc1ccc(C(C)=O)cc1COC(=O)CN1C(=O)N[C@@]2(C[C@H](C)CC(C)(C)C2)C1=O |
| InChI | InChI=1S/C23H30N2O6/c1-14-9-22(3,4)13-23(10-14)20(28)25(21(29)24-23)11-19(27)31-12-17-8-16(15(2)26)6-7-18(17)30-5/h6-8,14H,9-13H2,1-5H3,(H,24,29)/t14-,23-/m1/s1 |
| InChIKey | FJGFWDAWWQEGFG-QKFKETGDSA-N |
| XLogP | 3.08 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|