C18H22N2O6 — CID 7793463
(5-acetyl-2-methoxyphenyl)methyl 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7793463) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7793463 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CC[C@]1(C)NC(=O)N(CC(=O)OCc2cc(C(C)=O)ccc2OC)C1=O |
| InChI | InChI=1S/C18H22N2O6/c1-5-18(3)16(23)20(17(24)19-18)9-15(22)26-10-13-8-12(11(2)21)6-7-14(13)25-4/h6-8H,5,9-10H2,1-4H3,(H,19,24)/t18-/m0/s1 |
| InChIKey | HKJNZEMNYQTYOJ-SFHVURJKSA-N |
| XLogP | 1.66 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|