C17H20ClN3O6 — CID 7793917
[2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7793917) has the molecular formula C17H20ClN3O6 and a molecular weight of 397.82 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7793917 |
| Molecular Formula | C17H20ClN3O6 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CC[C@]1(C)NC(=O)N(CC(=O)OCC(=O)Nc2ccc(OC)c(Cl)c2)C1=O |
| InChI | InChI=1S/C17H20ClN3O6/c1-4-17(2)15(24)21(16(25)20-17)8-14(23)27-9-13(22)19-10-5-6-12(26-3)11(18)7-10/h5-7H,4,8-9H2,1-3H3,(H,19,22)(H,20,25)/t17-/m0/s1 |
| InChIKey | ASDLBBZWJNLMDM-KRWDZBQOSA-N |
| XLogP | 1.55 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|