C18H22ClN3O5 — CID 7793430
[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7793430) has the molecular formula C18H22ClN3O5 and a molecular weight of 395.84 g/mol. Its IUPAC name is [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7793430 |
| Molecular Formula | C18H22ClN3O5 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CC[C@]1(C)NC(=O)N(CC(=O)OCC(=O)Nc2c(C)cc(C)cc2Cl)C1=O |
| InChI | InChI=1S/C18H22ClN3O5/c1-5-18(4)16(25)22(17(26)21-18)8-14(24)27-9-13(23)20-15-11(3)6-10(2)7-12(15)19/h6-7H,5,8-9H2,1-4H3,(H,20,23)(H,21,26)/t18-/m0/s1 |
| InChIKey | RTZMGNCYBGOXBO-SFHVURJKSA-N |
| XLogP | 2.16 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|