C17H20N4O7 — CID 55311252
[2-(4-methyl-2-nitroanilino)-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 55311252) has the molecular formula C17H20N4O7 and a molecular weight of 392.37 g/mol. Its IUPAC name is [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 55311252 |
| Molecular Formula | C17H20N4O7 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(C)NC(=O)N(CC(=O)OCC(=O)Nc2ccc(C)cc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C17H20N4O7/c1-4-17(3)15(24)20(16(25)19-17)8-14(23)28-9-13(22)18-11-6-5-10(2)7-12(11)21(26)27/h5-7H,4,8-9H2,1-3H3,(H,18,22)(H,19,25) |
| InChIKey | XATNJSDZLWEMKX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|