C21H19ClN4O7 — CID 55310015
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate (PubChem CID 55310015) has the molecular formula C21H19ClN4O7 and a molecular weight of 474.86 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 55310015 |
| Molecular Formula | C21H19ClN4O7 |
| Molecular Weight | 474.86 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)OCC(=O)Nc2ccc(Cl)cc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C21H19ClN4O7/c1-2-21(13-6-4-3-5-7-13)19(29)25(20(30)24-21)11-18(28)33-12-17(27)23-15-9-8-14(22)10-16(15)26(31)32/h3-10H,2,11-12H2,1H3,(H,23,27)(H,24,30) |
| InChIKey | NMCWBFWVGGECMW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.86 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|