C19H21ClN4O7 — CID 27188099
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate (PubChem CID 27188099) has the molecular formula C19H21ClN4O7 and a molecular weight of 452.85 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate |
|---|---|
| PubChem CID | 27188099 |
| Molecular Formula | C19H21ClN4O7 |
| Molecular Weight | 452.85 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoate |
| SMILES | O=C(COC(=O)CCN1C(=O)NC2(CCCCC2)C1=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21ClN4O7/c20-12-4-5-13(14(10-12)24(29)30)21-15(25)11-31-16(26)6-9-23-17(27)19(22-18(23)28)7-2-1-3-8-19/h4-5,10H,1-3,6-9,11H2,(H,21,25)(H,22,28) |
| InChIKey | UMBDSTDURFLJFN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.85 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|