C24H36N3O4+ — CID 11944302
(5S,9S)-3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 11944302) has the molecular formula C24H36N3O4+ and a molecular weight of 430.57 g/mol. Its IUPAC name is (5S,9S)-3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,9S)-3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 11944302 |
| Molecular Formula | C24H36N3O4+ |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (5S,9S)-3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1ccc(OC)c([C@H]2CCC[NH+]2CN2C(=O)N[C@]3(C[C@@H](C)CC(C)(C)C3)C2=O)c1 |
| InChI | InChI=1S/C24H35N3O4/c1-16-12-23(2,3)14-24(13-16)21(28)27(22(29)25-24)15-26-10-6-7-19(26)18-11-17(30-4)8-9-20(18)31-5/h8-9,11,16,19H,6-7,10,12-15H2,1-5H3,(H,25,29)/p+1/t16-,19+,24-/m0/s1 |
| InChIKey | HOHBDUQEQNDIOL-WVCKHHOPSA-O |
| XLogP | 2.52 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|