C22H32N3O4+ — CID 9285479
3-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9285479) has the molecular formula C22H32N3O4+ and a molecular weight of 402.52 g/mol. Its IUPAC name is 3-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9285479 |
| Molecular Formula | C22H32N3O4+ |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 3-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1ccc([C@H]2CCC[NH+]2CN2C(=O)NC3(CCC(C)CC3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C22H31N3O4/c1-15-8-10-22(11-9-15)20(26)25(21(27)23-22)14-24-12-4-5-18(24)17-7-6-16(28-2)13-19(17)29-3/h6-7,13,15,18H,4-5,8-12,14H2,1-3H3,(H,23,27)/p+1/t15?,18-,22?/m1/s1 |
| InChIKey | JEIWHUQEVQSMLO-GXPWMBGSSA-O |
| XLogP | 1.88 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|