C18H24N3O5+ — CID 9285575
1-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-3-ethylimidazolidine-2,4,5-trione (PubChem CID 9285575) has the molecular formula C18H24N3O5+ and a molecular weight of 362.41 g/mol. Its IUPAC name is 1-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-3-ethylimidazolidine-2,4,5-trione.
| Compound Name | 1-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-3-ethylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9285575 |
| Molecular Formula | C18H24N3O5+ |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-[[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-3-ethylimidazolidine-2,4,5-trione |
| SMILES | CCN1C(=O)C(=O)N(C[NH+]2CCC[C@@H]2c2ccc(OC)cc2OC)C1=O |
| InChI | InChI=1S/C18H23N3O5/c1-4-20-16(22)17(23)21(18(20)24)11-19-9-5-6-14(19)13-8-7-12(25-2)10-15(13)26-3/h7-8,10,14H,4-6,9,11H2,1-3H3/p+1/t14-/m1/s1 |
| InChIKey | DEBCBNPFAQCRLO-CQSZACIVSA-O |
| XLogP | 0.19 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|