C23H29N4O2S+ — CID 9285565
2-[[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione (PubChem CID 9285565) has the molecular formula C23H29N4O2S+ and a molecular weight of 425.58 g/mol. Its IUPAC name is 2-[[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9285565 |
| Molecular Formula | C23H29N4O2S+ |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-[[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2ccccc2)nn(C[NH+]2CCC[C@H]2c2ccc(OC)cc2OC)c1=S |
| InChI | InChI=1S/C23H28N4O2S/c1-4-26-22(17-9-6-5-7-10-17)24-27(23(26)30)16-25-14-8-11-20(25)19-13-12-18(28-2)15-21(19)29-3/h5-7,9-10,12-13,15,20H,4,8,11,14,16H2,1-3H3/p+1/t20-/m0/s1 |
| InChIKey | LMFCTTJBBAJHLW-FQEVSTJZSA-O |
| XLogP | 3.50 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|