C18H26N3O2S3+ — CID 9285389
3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-5-propylsulfanyl-1,3,4-thiadiazole-2-thione (PubChem CID 9285389) has the molecular formula C18H26N3O2S3+ and a molecular weight of 412.63 g/mol. Its IUPAC name is 3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-5-propylsulfanyl-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-5-propylsulfanyl-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 9285389 |
| Molecular Formula | C18H26N3O2S3+ |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-5-propylsulfanyl-1,3,4-thiadiazole-2-thione |
| SMILES | CCCSc1nn(C[NH+]2CCC[C@@H]2c2cc(OC)ccc2OC)c(=S)s1 |
| InChI | InChI=1S/C18H25N3O2S3/c1-4-10-25-17-19-21(18(24)26-17)12-20-9-5-6-15(20)14-11-13(22-2)7-8-16(14)23-3/h7-8,11,15H,4-6,9-10,12H2,1-3H3/p+1/t15-/m1/s1 |
| InChIKey | HBYHXVIOCXMCKN-OAHLLOKOSA-O |
| XLogP | 3.57 |
| TPSA | 40.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|