C19H23N4O2S2+ — CID 9285281
2-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione (PubChem CID 9285281) has the molecular formula C19H23N4O2S2+ and a molecular weight of 403.55 g/mol. Its IUPAC name is 2-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9285281 |
| Molecular Formula | C19H23N4O2S2+ |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(OC)c([C@H]2CCC[NH+]2Cn2[nH]c(-c3cccs3)nc2=S)c1 |
| InChI | InChI=1S/C19H22N4O2S2/c1-24-13-7-8-16(25-2)14(11-13)15-5-3-9-22(15)12-23-19(26)20-18(21-23)17-6-4-10-27-17/h4,6-8,10-11,15H,3,5,9,12H2,1-2H3,(H,20,21,26)/p+1/t15-/m1/s1 |
| InChIKey | FEMPSKOOYVSSCF-OAHLLOKOSA-O |
| XLogP | 3.06 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|