C15H17N4S3+ — CID 9321338
2-[[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione (PubChem CID 9321338) has the molecular formula C15H17N4S3+ and a molecular weight of 349.53 g/mol. Its IUPAC name is 2-[[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9321338 |
| Molecular Formula | C15H17N4S3+ |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-[[(4S)-4-methyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
| SMILES | C[C@H]1c2ccsc2CC[NH+]1Cn1[nH]c(-c2cccs2)nc1=S |
| InChI | InChI=1S/C15H16N4S3/c1-10-11-5-8-22-12(11)4-6-18(10)9-19-15(20)16-14(17-19)13-3-2-7-21-13/h2-3,5,7-8,10H,4,6,9H2,1H3,(H,16,17,20)/p+1/t10-/m0/s1 |
| InChIKey | ZMZOLHFLWMADNJ-JTQLQIEISA-O |
| XLogP | 2.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|