C15H21N4O2S2+ — CID 7911137
ethyl 1-[(3-sulfanylidene-5-thiophen-2-yl-1H-1,2,4-triazol-2-yl)methyl]piperidin-1-ium-4-carboxylate (PubChem CID 7911137) has the molecular formula C15H21N4O2S2+ and a molecular weight of 353.49 g/mol. Its IUPAC name is ethyl 1-[(3-sulfanylidene-5-thiophen-2-yl-1H-1,2,4-triazol-2-yl)methyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(3-sulfanylidene-5-thiophen-2-yl-1H-1,2,4-triazol-2-yl)methyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 7911137 |
| Molecular Formula | C15H21N4O2S2+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | ethyl 1-[(3-sulfanylidene-5-thiophen-2-yl-1H-1,2,4-triazol-2-yl)methyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](Cn2[nH]c(-c3cccs3)nc2=S)CC1 |
| InChI | InChI=1S/C15H20N4O2S2/c1-2-21-14(20)11-5-7-18(8-6-11)10-19-15(22)16-13(17-19)12-4-3-9-23-12/h3-4,9,11H,2,5-8,10H2,1H3,(H,16,17,22)/p+1 |
| InChIKey | JNHLAMSMAUKTRE-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|