C21H24N4O2S2 — CID 2377574
ethyl 1-[(4-phenyl-5-sulfanylidene-3-thiophen-2-yl-1,2,4-triazol-1-yl)methyl]piperidine-4-carboxylate (PubChem CID 2377574) has the molecular formula C21H24N4O2S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is ethyl 1-[(4-phenyl-5-sulfanylidene-3-thiophen-2-yl-1,2,4-triazol-1-yl)methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(4-phenyl-5-sulfanylidene-3-thiophen-2-yl-1,2,4-triazol-1-yl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 2377574 |
| Molecular Formula | C21H24N4O2S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | ethyl 1-[(4-phenyl-5-sulfanylidene-3-thiophen-2-yl-1,2,4-triazol-1-yl)methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cn2nc(-c3cccs3)n(-c3ccccc3)c2=S)CC1 |
| InChI | InChI=1S/C21H24N4O2S2/c1-2-27-20(26)16-10-12-23(13-11-16)15-24-21(28)25(17-7-4-3-5-8-17)19(22-24)18-9-6-14-29-18/h3-9,14,16H,2,10-13,15H2,1H3 |
| InChIKey | FOWUVLVWYTVOGE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|