C17H24N4O2S2 — CID 3472724
ethyl 1-[(4-ethyl-5-sulfanylidene-3-thiophen-2-yl-1,2,4-triazol-1-yl)methyl]piperidine-3-carboxylate (PubChem CID 3472724) has the molecular formula C17H24N4O2S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is ethyl 1-[(4-ethyl-5-sulfanylidene-3-thiophen-2-yl-1,2,4-triazol-1-yl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(4-ethyl-5-sulfanylidene-3-thiophen-2-yl-1,2,4-triazol-1-yl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 3472724 |
| Molecular Formula | C17H24N4O2S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | ethyl 1-[(4-ethyl-5-sulfanylidene-3-thiophen-2-yl-1,2,4-triazol-1-yl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(Cn2nc(-c3cccs3)n(CC)c2=S)C1 |
| InChI | InChI=1S/C17H24N4O2S2/c1-3-20-15(14-8-6-10-25-14)18-21(17(20)24)12-19-9-5-7-13(11-19)16(22)23-4-2/h6,8,10,13H,3-5,7,9,11-12H2,1-2H3 |
| InChIKey | UYYJHORVYZCSIV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|