C16H19N3O2S — CID 171989103
ethyl 1-(4-thiophen-2-ylpyrimidin-2-yl)piperidine-3-carboxylate (PubChem CID 171989103) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is ethyl 1-(4-thiophen-2-ylpyrimidin-2-yl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(4-thiophen-2-ylpyrimidin-2-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 171989103 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | ethyl 1-(4-thiophen-2-ylpyrimidin-2-yl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2nccc(-c3cccs3)n2)C1 |
| InChI | InChI=1S/C16H19N3O2S/c1-2-21-15(20)12-5-3-9-19(11-12)16-17-8-7-13(18-16)14-6-4-10-22-14/h4,6-8,10,12H,2-3,5,9,11H2,1H3 |
| InChIKey | CYZYTQSXVZATFR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |