C12H15Cl2N3O2 — CID 135137910
ethyl (3R)-1-(4,5-dichloropyrimidin-2-yl)piperidine-3-carboxylate (PubChem CID 135137910) has the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.18 g/mol. Its IUPAC name is ethyl (3R)-1-(4,5-dichloropyrimidin-2-yl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(4,5-dichloropyrimidin-2-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 135137910 |
| Molecular Formula | C12H15Cl2N3O2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | ethyl (3R)-1-(4,5-dichloropyrimidin-2-yl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(c2ncc(Cl)c(Cl)n2)C1 |
| InChI | InChI=1S/C12H15Cl2N3O2/c1-2-19-11(18)8-4-3-5-17(7-8)12-15-6-9(13)10(14)16-12/h6,8H,2-5,7H2,1H3/t8-/m1/s1 |
| InChIKey | QGUBUIYSSHVQOD-MRVPVSSYSA-N |
| XLogP | 2.56 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |