C15H18N4O2 — CID 103204945
ethyl 1-(1,2,4-benzotriazin-3-yl)piperidine-3-carboxylate (PubChem CID 103204945) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is ethyl 1-(1,2,4-benzotriazin-3-yl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(1,2,4-benzotriazin-3-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 103204945 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl 1-(1,2,4-benzotriazin-3-yl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2nnc3ccccc3n2)C1 |
| InChI | InChI=1S/C15H18N4O2/c1-2-21-14(20)11-6-5-9-19(10-11)15-16-12-7-3-4-8-13(12)17-18-15/h3-4,7-8,11H,2,5-6,9-10H2,1H3 |
| InChIKey | CUTOPIXABFUUOV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |