C17H18F3N3O2 — CID 56731130
ethyl 1-[2-(trifluoromethyl)quinazolin-4-yl]piperidine-3-carboxylate (PubChem CID 56731130) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is ethyl 1-[2-(trifluoromethyl)quinazolin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-(trifluoromethyl)quinazolin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 56731130 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | ethyl 1-[2-(trifluoromethyl)quinazolin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2nc(C(F)(F)F)nc3ccccc23)C1 |
| InChI | InChI=1S/C17H18F3N3O2/c1-2-25-15(24)11-6-5-9-23(10-11)14-12-7-3-4-8-13(12)21-16(22-14)17(18,19)20/h3-4,7-8,11H,2,5-6,9-10H2,1H3 |
| InChIKey | DAGZPVMUJLNSAX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |