C19H21F3N2O2 — CID 23477113
ethyl 1-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]piperidine-3-carboxylate (PubChem CID 23477113) has the molecular formula C19H21F3N2O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is ethyl 1-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 23477113 |
| Molecular Formula | C19H21F3N2O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | ethyl 1-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2cc(C)nc3cc(C(F)(F)F)ccc23)C1 |
| InChI | InChI=1S/C19H21F3N2O2/c1-3-26-18(25)13-5-4-8-24(11-13)17-9-12(2)23-16-10-14(19(20,21)22)6-7-15(16)17/h6-7,9-10,13H,3-5,8,11H2,1-2H3 |
| InChIKey | PLJZKPYXRUCACS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |