C16H15F3N2O2 — CID 135116153
1-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]pyrrolidine-3-carboxylic acid (PubChem CID 135116153) has the molecular formula C16H15F3N2O2 and a molecular weight of 324.30 g/mol. Its IUPAC name is 1-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 135116153 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]pyrrolidine-3-carboxylic acid |
| SMILES | Cc1cc(N2CCC(C(=O)O)C2)c2ccc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C16H15F3N2O2/c1-9-6-14(21-5-4-10(8-21)15(22)23)12-3-2-11(16(17,18)19)7-13(12)20-9/h2-3,6-7,10H,4-5,8H2,1H3,(H,22,23) |
| InChIKey | NBFPTTJNMLTLCZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |