C15H19F3N2O2 — CID 59410086
ethyl (3S)-1-[4-amino-3-(trifluoromethyl)phenyl]piperidine-3-carboxylate (PubChem CID 59410086) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is ethyl (3S)-1-[4-amino-3-(trifluoromethyl)phenyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[4-amino-3-(trifluoromethyl)phenyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 59410086 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | ethyl (3S)-1-[4-amino-3-(trifluoromethyl)phenyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(c2ccc(N)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-2-22-14(21)10-4-3-7-20(9-10)11-5-6-13(19)12(8-11)15(16,17)18/h5-6,8,10H,2-4,7,9,19H2,1H3/t10-/m0/s1 |
| InChIKey | WMAAWQWIHVDHOU-JTQLQIEISA-N |
| XLogP | 3.07 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|