C16H16F3N3O2 — CID 21003589
1-[6-methyl-2-(trifluoromethyl)quinazolin-4-yl]piperidine-3-carboxylic acid (PubChem CID 21003589) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is 1-[6-methyl-2-(trifluoromethyl)quinazolin-4-yl]piperidine-3-carboxylic acid.
| Compound Name | 1-[6-methyl-2-(trifluoromethyl)quinazolin-4-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 21003589 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-[6-methyl-2-(trifluoromethyl)quinazolin-4-yl]piperidine-3-carboxylic acid |
| SMILES | Cc1ccc2nc(C(F)(F)F)nc(N3CCCC(C(=O)O)C3)c2c1 |
| InChI | InChI=1S/C16H16F3N3O2/c1-9-4-5-12-11(7-9)13(21-15(20-12)16(17,18)19)22-6-2-3-10(8-22)14(23)24/h4-5,7,10H,2-3,6,8H2,1H3,(H,23,24) |
| InChIKey | FAYQLLLCFVWFNH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |