C18H22N4O2 — CID 99975862
(3R)-1-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperidine-3-carboxylic acid (PubChem CID 99975862) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (3R)-1-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 99975862 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (3R)-1-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperidine-3-carboxylic acid |
| SMILES | Cc1ccc(Nc2cc(N3CCC[C@@H](C(=O)O)C3)nc(C)n2)cc1 |
| InChI | InChI=1S/C18H22N4O2/c1-12-5-7-15(8-6-12)21-16-10-17(20-13(2)19-16)22-9-3-4-14(11-22)18(23)24/h5-8,10,14H,3-4,9,11H2,1-2H3,(H,23,24)(H,19,20,21)/t14-/m1/s1 |
| InChIKey | OVHMZGXAIOPQQA-CQSZACIVSA-N |
| XLogP | 3.14 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |