C18H22N4O3 — CID 99975814
1-[6-(4-methoxyanilino)-2-methylpyrimidin-4-yl]piperidine-4-carboxylic acid (PubChem CID 99975814) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[6-(4-methoxyanilino)-2-methylpyrimidin-4-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-(4-methoxyanilino)-2-methylpyrimidin-4-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 99975814 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-[6-(4-methoxyanilino)-2-methylpyrimidin-4-yl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc(Nc2cc(N3CCC(C(=O)O)CC3)nc(C)n2)cc1 |
| InChI | InChI=1S/C18H22N4O3/c1-12-19-16(21-14-3-5-15(25-2)6-4-14)11-17(20-12)22-9-7-13(8-10-22)18(23)24/h3-6,11,13H,7-10H2,1-2H3,(H,23,24)(H,19,20,21) |
| InChIKey | MEPOXMCZHSUGBL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |