C16H19N3O2 — CID 60631772
ethyl 1-phthalazin-1-ylpiperidine-3-carboxylate (PubChem CID 60631772) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is ethyl 1-phthalazin-1-ylpiperidine-3-carboxylate.
| Compound Name | ethyl 1-phthalazin-1-ylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 60631772 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | ethyl 1-phthalazin-1-ylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2nncc3ccccc23)C1 |
| InChI | InChI=1S/C16H19N3O2/c1-2-21-16(20)13-7-5-9-19(11-13)15-14-8-4-3-6-12(14)10-17-18-15/h3-4,6,8,10,13H,2,5,7,9,11H2,1H3 |
| InChIKey | ZSRHIJSLKFVFPM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |