C18H22N2O3 — CID 169214498
ethyl (3S)-1-(8-methoxyisoquinolin-4-yl)piperidine-3-carboxylate (PubChem CID 169214498) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is ethyl (3S)-1-(8-methoxyisoquinolin-4-yl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-(8-methoxyisoquinolin-4-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 169214498 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | ethyl (3S)-1-(8-methoxyisoquinolin-4-yl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(c2cncc3c(OC)cccc23)C1 |
| InChI | InChI=1S/C18H22N2O3/c1-3-23-18(21)13-6-5-9-20(12-13)16-11-19-10-15-14(16)7-4-8-17(15)22-2/h4,7-8,10-11,13H,3,5-6,9,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | XVZHMMXBNBNBHD-ZDUSSCGKSA-N |
| XLogP | 3.02 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |