C15H21N5O4 — CID 134007614
ethyl 1-[4-(cyclopropylamino)-5-nitropyrimidin-2-yl]piperidine-3-carboxylate (PubChem CID 134007614) has the molecular formula C15H21N5O4 and a molecular weight of 335.36 g/mol. Its IUPAC name is ethyl 1-[4-(cyclopropylamino)-5-nitropyrimidin-2-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[4-(cyclopropylamino)-5-nitropyrimidin-2-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 134007614 |
| Molecular Formula | C15H21N5O4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | ethyl 1-[4-(cyclopropylamino)-5-nitropyrimidin-2-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncc([N+](=O)[O-])c(NC3CC3)n2)C1 |
| InChI | InChI=1S/C15H21N5O4/c1-2-24-14(21)10-4-3-7-19(9-10)15-16-8-12(20(22)23)13(18-15)17-11-5-6-11/h8,10-11H,2-7,9H2,1H3,(H,16,17,18) |
| InChIKey | IDIPCPPNCFJGTK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|