C13H17N3O4 — CID 62006232
ethyl 1-(4-nitro-2-pyridinyl)piperidine-3-carboxylate (PubChem CID 62006232) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is ethyl 1-(4-nitro-2-pyridinyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(4-nitro-2-pyridinyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 62006232 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | ethyl 1-(4-nitro-2-pyridinyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2cc([N+](=O)[O-])ccn2)C1 |
| InChI | InChI=1S/C13H17N3O4/c1-2-20-13(17)10-4-3-7-15(9-10)12-8-11(16(18)19)5-6-14-12/h5-6,8,10H,2-4,7,9H2,1H3 |
| InChIKey | ZPNLMNBWECXFDZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|