C16H23N3O2 — CID 126849578
ethyl 1-[6-(cyclopropylmethyl)pyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 126849578) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl 1-[6-(cyclopropylmethyl)pyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[6-(cyclopropylmethyl)pyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 126849578 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | ethyl 1-[6-(cyclopropylmethyl)pyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2cc(CC3CC3)ncn2)C1 |
| InChI | InChI=1S/C16H23N3O2/c1-2-21-16(20)13-4-3-7-19(10-13)15-9-14(17-11-18-15)8-12-5-6-12/h9,11-13H,2-8,10H2,1H3 |
| InChIKey | GNEPZHDRXLMYPZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |